About 2,4-dichloropyrido[2,3-d]pyrimidine
2,4-dichloropyrido[2,3-d]pyrimidine (PubChem CID 22222228) has the molecular formula C7H3Cl2N3
and a molecular weight of 200.03 g/mol. Its IUPAC name is 2,4-dichloropyrido[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloropyrido[2,3-d]pyrimidine |
| PubChem CID | 22222228 |
| Molecular Formula | C7H3Cl2N3 |
| Molecular Weight | 200.03 g/mol |
| Exact Mass | 198.97 |
| IUPAC Name | 2,4-dichloropyrido[2,3-d]pyrimidine |
| SMILES | Clc1nc(Cl)c2cccnc2n1 |
| InChI | InChI=1S/C7H3Cl2N3/c8-5-4-2-1-3-10-6(4)12-7(9)11-5/h1-3H |
| InChIKey | QSNSZGYDLUPWSV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.03 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloropyrido[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloropyrido[2,3-d]pyrimidine?
The IUPAC name of 2,4-dichloropyrido[2,3-d]pyrimidine (CID 22222228) is 2,4-dichloropyrido[2,3-d]pyrimidine.
What is the SMILES notation for 2,4-dichloropyrido[2,3-d]pyrimidine?
The canonical SMILES for 2,4-dichloropyrido[2,3-d]pyrimidine is Clc1nc(Cl)c2cccnc2n1.
What is the InChIKey of 2,4-dichloropyrido[2,3-d]pyrimidine?
The InChIKey is QSNSZGYDLUPWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N3/c8-5-4-2-1-3-10-6(4)12-7(9)11-5/h1-3H.
What are the key properties of 2,4-dichloropyrido[2,3-d]pyrimidine?
2,4-dichloropyrido[2,3-d]pyrimidine has a molecular weight of 200.03 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloropyrido[2,3-d]pyrimidine is sourced from PubChem (CID 22222228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).