About 3-amino-1,5-dimethylpyrazole-4-carbonitrile
3-amino-1,5-dimethylpyrazole-4-carbonitrile (PubChem CID 22222305) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 3-amino-1,5-dimethylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-1,5-dimethylpyrazole-4-carbonitrile |
| PubChem CID | 22222305 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3-amino-1,5-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1c(C#N)c(N)nn1C |
| InChI | InChI=1S/C6H8N4/c1-4-5(3-7)6(8)9-10(4)2/h1-2H3,(H2,8,9) |
| InChIKey | YFYUIVCSYNXULP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1,5-dimethylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,5-dimethylpyrazole-4-carbonitrile?
The IUPAC name of 3-amino-1,5-dimethylpyrazole-4-carbonitrile (CID 22222305) is 3-amino-1,5-dimethylpyrazole-4-carbonitrile.
What is the SMILES notation for 3-amino-1,5-dimethylpyrazole-4-carbonitrile?
The canonical SMILES for 3-amino-1,5-dimethylpyrazole-4-carbonitrile is Cc1c(C#N)c(N)nn1C.
What is the InChIKey of 3-amino-1,5-dimethylpyrazole-4-carbonitrile?
The InChIKey is YFYUIVCSYNXULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-4-5(3-7)6(8)9-10(4)2/h1-2H3,(H2,8,9).
What are the key properties of 3-amino-1,5-dimethylpyrazole-4-carbonitrile?
3-amino-1,5-dimethylpyrazole-4-carbonitrile has a molecular weight of 136.16 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,5-dimethylpyrazole-4-carbonitrile is sourced from PubChem (CID 22222305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).