About (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate
(2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate (PubChem CID 22222485) has the molecular formula C16H15F2NO2
and a molecular weight of 291.30 g/mol. Its IUPAC name is (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate |
| PubChem CID | 22222485 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate |
| SMILES | CCc1nc2cc(F)c(F)cc2c(OC(=O)C2CC2)c1C |
| InChI | InChI=1S/C16H15F2NO2/c1-3-13-8(2)15(21-16(20)9-4-5-9)10-6-11(17)12(18)7-14(10)19-13/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | GBJBYCUNPFZNFT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate?
The IUPAC name of (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate (CID 22222485) is (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate.
What is the SMILES notation for (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate?
The canonical SMILES for (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate is CCc1nc2cc(F)c(F)cc2c(OC(=O)C2CC2)c1C.
What is the InChIKey of (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate?
The InChIKey is GBJBYCUNPFZNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO2/c1-3-13-8(2)15(21-16(20)9-4-5-9)10-6-11(17)12(18)7-14(10)19-13/h6-7,9H,3-5H2,1-2H3.
What are the key properties of (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate?
(2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate has a molecular weight of 291.30 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6,7-difluoro-3-methylquinolin-4-yl) cyclopropanecarboxylate is sourced from PubChem (CID 22222485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).