C7H10N6O — CID 22222770
N-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylprop-2-enamide (PubChem CID 22222770) has the molecular formula C7H10N6O and a molecular weight of 194.20 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylprop-2-enamide.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22222770 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H10N6O/c1-3(2)4(14)10-7-12-5(8)11-6(9)13-7/h1H2,2H3,(H5,8,9,10,11,12,13,14) |
| InChIKey | UIMBTQACRRGERV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|