About 3-(Methoxysilyl)propyl 2-methylprop-2-enoate
3-(Methoxysilyl)propyl 2-methylprop-2-enoate (PubChem CID 22222807) has the molecular formula C8H14O3Si
and a molecular weight of 186.28 g/mol.
Molecular Properties
| Compound Name | 3-(Methoxysilyl)propyl 2-methylprop-2-enoate |
| PubChem CID | 22222807 |
| Molecular Formula | C8H14O3Si |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si]OC |
| InChI | InChI=1S/C8H14O3Si/c1-7(2)8(9)11-5-4-6-12-10-3/h1,4-6H2,2-3H3 |
| InChIKey | FZWORCNJMBFZCE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(Methoxysilyl)propyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(Methoxysilyl)propyl 2-methylprop-2-enoate?
The IUPAC name of 3-(Methoxysilyl)propyl 2-methylprop-2-enoate (CID 22222807) is not available.
What is the SMILES notation for 3-(Methoxysilyl)propyl 2-methylprop-2-enoate?
The canonical SMILES for 3-(Methoxysilyl)propyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC[Si]OC.
What is the InChIKey of 3-(Methoxysilyl)propyl 2-methylprop-2-enoate?
The InChIKey is FZWORCNJMBFZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3Si/c1-7(2)8(9)11-5-4-6-12-10-3/h1,4-6H2,2-3H3.
What are the key properties of 3-(Methoxysilyl)propyl 2-methylprop-2-enoate?
3-(Methoxysilyl)propyl 2-methylprop-2-enoate has a molecular weight of 186.28 g/mol, XLogP of 1.18, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(Methoxysilyl)propyl 2-methylprop-2-enoate is sourced from PubChem (CID 22222807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).