About 2,5-dichlorobenzene-1,3-dicarbonitrile
2,5-dichlorobenzene-1,3-dicarbonitrile (PubChem CID 22222968) has the molecular formula C8H2Cl2N2
and a molecular weight of 197.02 g/mol. Its IUPAC name is 2,5-dichlorobenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2,5-dichlorobenzene-1,3-dicarbonitrile |
| PubChem CID | 22222968 |
| Molecular Formula | C8H2Cl2N2 |
| Molecular Weight | 197.02 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | 2,5-dichlorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(Cl)cc(C#N)c1Cl |
| InChI | InChI=1S/C8H2Cl2N2/c9-7-1-5(3-11)8(10)6(2-7)4-12/h1-2H |
| InChIKey | CNHBUKOQNKTNEU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.02 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dichlorobenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichlorobenzene-1,3-dicarbonitrile?
The IUPAC name of 2,5-dichlorobenzene-1,3-dicarbonitrile (CID 22222968) is 2,5-dichlorobenzene-1,3-dicarbonitrile.
What is the SMILES notation for 2,5-dichlorobenzene-1,3-dicarbonitrile?
The canonical SMILES for 2,5-dichlorobenzene-1,3-dicarbonitrile is N#Cc1cc(Cl)cc(C#N)c1Cl.
What is the InChIKey of 2,5-dichlorobenzene-1,3-dicarbonitrile?
The InChIKey is CNHBUKOQNKTNEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl2N2/c9-7-1-5(3-11)8(10)6(2-7)4-12/h1-2H.
What are the key properties of 2,5-dichlorobenzene-1,3-dicarbonitrile?
2,5-dichlorobenzene-1,3-dicarbonitrile has a molecular weight of 197.02 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorobenzene-1,3-dicarbonitrile is sourced from PubChem (CID 22222968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).