About CID 22223102
CID 22223102 (PubChem CID 22223102) has the molecular formula C11H27O3Si4
and a molecular weight of 319.68 g/mol.
Molecular Properties
| Compound Name | CID 22223102 |
| PubChem CID | 22223102 |
| Molecular Formula | C11H27O3Si4 |
| Molecular Weight | 319.68 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)OC([Si])=C(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H27O3Si4/c1-16(2,3)12-10(13-17(4,5)6)11(15)14-18(7,8)9/h1-9H3 |
| InChIKey | UHHRITCFGDCWBB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22223102 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22223102?
The IUPAC name of CID 22223102 (CID 22223102) is not available.
What is the SMILES notation for CID 22223102?
The canonical SMILES for CID 22223102 is C[Si](C)(C)OC([Si])=C(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of CID 22223102?
The InChIKey is UHHRITCFGDCWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27O3Si4/c1-16(2,3)12-10(13-17(4,5)6)11(15)14-18(7,8)9/h1-9H3.
What are the key properties of CID 22223102?
CID 22223102 has a molecular weight of 319.68 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22223102 is sourced from PubChem (CID 22223102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).