C7H10N2O2 — CID 22223251
1,5,6-trimethylpyrimidine-2,4-dione (PubChem CID 22223251) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1,5,6-trimethylpyrimidine-2,4-dione.
| Compound Name | 1,5,6-trimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22223251 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1,5,6-trimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(C)n(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H10N2O2/c1-4-5(2)9(3)7(11)8-6(4)10/h1-3H3,(H,8,10,11) |
| InChIKey | NNCXZMUWQDELNF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |