C39H44N4O7 — CID 22223350
tribenzyl 10-(3-methoxyphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 22223350) has the molecular formula C39H44N4O7 and a molecular weight of 680.80 g/mol. Its IUPAC name is tribenzyl 10-(3-methoxyphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tribenzyl 10-(3-methoxyphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 22223350 |
| Molecular Formula | C39H44N4O7 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | tribenzyl 10-(3-methoxyphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | COc1cccc(N2CCN(C(=O)OCc3ccccc3)CCN(C(=O)OCc3ccccc3)CCN(C(=O)OCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C39H44N4O7/c1-47-36-19-11-18-35(28-36)40-20-22-41(37(44)48-29-32-12-5-2-6-13-32)24-26-43(39(46)50-31-34-16-9-4-10-17-34)27-25-42(23-21-40)38(45)49-30-33-14-7-3-8-15-33/h2-19,28H,20-27,29-31H2,1H3 |
| InChIKey | BYPCQGXDPILYNG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 101.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|