About 2-methyloxane sulfamate
2-methyloxane sulfamate (PubChem CID 22223465) has the molecular formula C6H14NO4S-
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-methyloxane sulfamate.
Molecular Properties
| Compound Name | 2-methyloxane sulfamate |
| PubChem CID | 22223465 |
| Molecular Formula | C6H14NO4S- |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-methyloxane sulfamate |
| SMILES | CC1CCCCO1.NS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H12O.H3NO3S/c1-6-4-2-3-5-7-6;1-5(2,3)4/h6H,2-5H2,1H3;(H3,1,2,3,4)/p-1 |
| InChIKey | CGZREJGYVINENY-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloxane sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloxane sulfamate?
The IUPAC name of 2-methyloxane sulfamate (CID 22223465) is 2-methyloxane sulfamate.
What is the SMILES notation for 2-methyloxane sulfamate?
The canonical SMILES for 2-methyloxane sulfamate is CC1CCCCO1.NS(=O)(=O)[O-].
What is the InChIKey of 2-methyloxane sulfamate?
The InChIKey is CGZREJGYVINENY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O.H3NO3S/c1-6-4-2-3-5-7-6;1-5(2,3)4/h6H,2-5H2,1H3;(H3,1,2,3,4)/p-1.
What are the key properties of 2-methyloxane sulfamate?
2-methyloxane sulfamate has a molecular weight of 196.25 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxane sulfamate is sourced from PubChem (CID 22223465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).