About 9-methyldocosane
9-methyldocosane (PubChem CID 22223822) has the molecular formula C23H48
and a molecular weight of 324.64 g/mol. Its IUPAC name is 9-methyldocosane.
Molecular Properties
| Compound Name | 9-methyldocosane |
| PubChem CID | 22223822 |
| Molecular Formula | C23H48 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.38 |
| IUPAC Name | 9-methyldocosane |
| SMILES | CCCCCCCCCCCCCC(C)CCCCCCCC |
| InChI | InChI=1S/C23H48/c1-4-6-8-10-12-13-14-15-16-18-20-22-23(3)21-19-17-11-9-7-5-2/h23H,4-22H2,1-3H3 |
| InChIKey | ZCELPTJBINQNKO-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldocosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldocosane?
The IUPAC name of 9-methyldocosane (CID 22223822) is 9-methyldocosane.
What is the SMILES notation for 9-methyldocosane?
The canonical SMILES for 9-methyldocosane is CCCCCCCCCCCCCC(C)CCCCCCCC.
What is the InChIKey of 9-methyldocosane?
The InChIKey is ZCELPTJBINQNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48/c1-4-6-8-10-12-13-14-15-16-18-20-22-23(3)21-19-17-11-9-7-5-2/h23H,4-22H2,1-3H3.
What are the key properties of 9-methyldocosane?
9-methyldocosane has a molecular weight of 324.64 g/mol, XLogP of 9.07, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldocosane is sourced from PubChem (CID 22223822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).