About 6-ethyl-4-methyldecane
6-ethyl-4-methyldecane (PubChem CID 22224210) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 6-ethyl-4-methyldecane.
Molecular Properties
| Compound Name | 6-ethyl-4-methyldecane |
| PubChem CID | 22224210 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 6-ethyl-4-methyldecane |
| SMILES | CCCCC(CC)CC(C)CCC |
| InChI | InChI=1S/C13H28/c1-5-8-10-13(7-3)11-12(4)9-6-2/h12-13H,5-11H2,1-4H3 |
| InChIKey | LAINOAGGKSXVBQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-ethyl-4-methyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-methyldecane?
The IUPAC name of 6-ethyl-4-methyldecane (CID 22224210) is 6-ethyl-4-methyldecane.
What is the SMILES notation for 6-ethyl-4-methyldecane?
The canonical SMILES for 6-ethyl-4-methyldecane is CCCCC(CC)CC(C)CCC.
What is the InChIKey of 6-ethyl-4-methyldecane?
The InChIKey is LAINOAGGKSXVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28/c1-5-8-10-13(7-3)11-12(4)9-6-2/h12-13H,5-11H2,1-4H3.
What are the key properties of 6-ethyl-4-methyldecane?
6-ethyl-4-methyldecane has a molecular weight of 184.37 g/mol, XLogP of 5.03, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-methyldecane is sourced from PubChem (CID 22224210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).