About 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one
4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one (PubChem CID 22224514) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one |
| PubChem CID | 22224514 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one |
| SMILES | O=C1C=CSC2N=CC=CC12 |
| InChI | InChI=1S/C8H7NOS/c10-7-3-5-11-8-6(7)2-1-4-9-8/h1-6,8H |
| InChIKey | YHHBRVLJYHLUJR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one?
The IUPAC name of 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one (CID 22224514) is 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one.
What is the SMILES notation for 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one?
The canonical SMILES for 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one is O=C1C=CSC2N=CC=CC12.
What is the InChIKey of 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one?
The InChIKey is YHHBRVLJYHLUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-7-3-5-11-8-6(7)2-1-4-9-8/h1-6,8H.
What are the key properties of 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one?
4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one has a molecular weight of 165.22 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydrothiopyrano[2,3-b]pyridin-4-one is sourced from PubChem (CID 22224514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).