C10H10N4O — CID 22224520
2-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-11-carbaldehyde (PubChem CID 22224520) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-11-carbaldehyde.
| Compound Name | 2-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-11-carbaldehyde |
|---|---|
| PubChem CID | 22224520 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-11-carbaldehyde |
| SMILES | Cc1c2c(nc3nc(C=O)nn13)CCC2 |
| InChI | InChI=1S/C10H10N4O/c1-6-7-3-2-4-8(7)11-10-12-9(5-15)13-14(6)10/h5H,2-4H2,1H3 |
| InChIKey | QTJLXWKLTUCJAK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|