About 3-bromooxan-4-one
3-bromooxan-4-one (PubChem CID 22224541) has the molecular formula C5H7BrO2
and a molecular weight of 179.01 g/mol. Its IUPAC name is 3-bromooxan-4-one.
Molecular Properties
| Compound Name | 3-bromooxan-4-one |
| PubChem CID | 22224541 |
| Molecular Formula | C5H7BrO2 |
| Molecular Weight | 179.01 g/mol |
| Exact Mass | 177.96 |
| IUPAC Name | 3-bromooxan-4-one |
| SMILES | O=C1CCOCC1Br |
| InChI | InChI=1S/C5H7BrO2/c6-4-3-8-2-1-5(4)7/h4H,1-3H2 |
| InChIKey | ZGULSQDBOSMIBZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.01 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromooxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromooxan-4-one?
The IUPAC name of 3-bromooxan-4-one (CID 22224541) is 3-bromooxan-4-one.
What is the SMILES notation for 3-bromooxan-4-one?
The canonical SMILES for 3-bromooxan-4-one is O=C1CCOCC1Br.
What is the InChIKey of 3-bromooxan-4-one?
The InChIKey is ZGULSQDBOSMIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO2/c6-4-3-8-2-1-5(4)7/h4H,1-3H2.
What are the key properties of 3-bromooxan-4-one?
3-bromooxan-4-one has a molecular weight of 179.01 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromooxan-4-one is sourced from PubChem (CID 22224541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).