C27H19FN4O — CID 22224761
8-[2-(4-fluorophenyl)ethynyl]-4-[3-(4-methylimidazol-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22224761) has the molecular formula C27H19FN4O and a molecular weight of 434.47 g/mol. Its IUPAC name is 8-[2-(4-fluorophenyl)ethynyl]-4-[3-(4-methylimidazol-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 8-[2-(4-fluorophenyl)ethynyl]-4-[3-(4-methylimidazol-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22224761 |
| Molecular Formula | C27H19FN4O |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 8-[2-(4-fluorophenyl)ethynyl]-4-[3-(4-methylimidazol-1-yl)phenyl]-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | Cc1cn(-c2cccc(C3=Nc4ccc(C#Cc5ccc(F)cc5)cc4NC(=O)C3)c2)cn1 |
| InChI | InChI=1S/C27H19FN4O/c1-18-16-32(17-29-18)23-4-2-3-21(14-23)25-15-27(33)31-26-13-20(9-12-24(26)30-25)6-5-19-7-10-22(28)11-8-19/h2-4,7-14,16-17H,15H2,1H3,(H,31,33) |
| InChIKey | LKAVVNWQCXGNTP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|