3-(triazol-1-yl)benzoic acid

C9H7N3O2 — CID 22224853

IUPAC3-(triazol-1-yl)benzoic acid
SMILESO=C(O)c1cccc(-n2ccnn2)c1
InChIInChI=1S/C9H7N3O2/c13-9(14)7-2-1-3-8(6-7)12-5-4-10-11-12/h1-6H,(H,13,14)
InChIKeyNDILQXVACSSLIV-UHFFFAOYSA-N
MW189.17 g/mol
LogP0.97
Rot. Bonds2

About 3-(triazol-1-yl)benzoic acid

3-(triazol-1-yl)benzoic acid (PubChem CID 22224853) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-(triazol-1-yl)benzoic acid.

Molecular Properties

Compound Name3-(triazol-1-yl)benzoic acid
PubChem CID22224853
Molecular FormulaC9H7N3O2
Molecular Weight189.17 g/mol
Exact Mass189.05
IUPAC Name3-(triazol-1-yl)benzoic acid
SMILESO=C(O)c1cccc(-n2ccnn2)c1
InChIInChI=1S/C9H7N3O2/c13-9(14)7-2-1-3-8(6-7)12-5-4-10-11-12/h1-6H,(H,13,14)
InChIKeyNDILQXVACSSLIV-UHFFFAOYSA-N
XLogP0.97
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.17
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(triazol-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(triazol-1-yl)benzoic acid?
The IUPAC name of 3-(triazol-1-yl)benzoic acid (CID 22224853) is 3-(triazol-1-yl)benzoic acid.
What is the SMILES notation for 3-(triazol-1-yl)benzoic acid?
The canonical SMILES for 3-(triazol-1-yl)benzoic acid is O=C(O)c1cccc(-n2ccnn2)c1.
What is the InChIKey of 3-(triazol-1-yl)benzoic acid?
The InChIKey is NDILQXVACSSLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c13-9(14)7-2-1-3-8(6-7)12-5-4-10-11-12/h1-6H,(H,13,14).
What are the key properties of 3-(triazol-1-yl)benzoic acid?
3-(triazol-1-yl)benzoic acid has a molecular weight of 189.17 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(triazol-1-yl)benzoic acid is sourced from PubChem (CID 22224853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).