C31H31N5O2 — CID 22225428
4-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]-N-benzylbenzamide (PubChem CID 22225428) has the molecular formula C31H31N5O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]-N-benzylbenzamide.
| Compound Name | 4-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 22225428 |
| Molecular Formula | C31H31N5O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 4-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-4-methyl-7-oxopyrido[2,3-d]pyrimidin-8-yl]-N-benzylbenzamide |
| SMILES | Cc1nc(N2CCC3CCCC=C3C2)nc2c1ccc(=O)n2-c1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N5O2/c1-21-27-15-16-28(37)36(26-13-11-24(12-14-26)30(38)32-19-22-7-3-2-4-8-22)29(27)34-31(33-21)35-18-17-23-9-5-6-10-25(23)20-35/h2-4,7-8,10-16,23H,5-6,9,17-20H2,1H3,(H,32,38) |
| InChIKey | KLJSRCUGTZKMFV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|