C5H8N4 — CID 22225482
4,7,8,9-tetrahydro-1H-purine (PubChem CID 22225482) has the molecular formula C5H8N4 and a molecular weight of 124.15 g/mol. Its IUPAC name is 4,7,8,9-tetrahydro-1H-purine.
| Compound Name | 4,7,8,9-tetrahydro-1H-purine |
|---|---|
| PubChem CID | 22225482 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 4,7,8,9-tetrahydro-1H-purine |
| SMILES | C1=NC2NCNC2=CN1 |
| InChI | InChI=1S/C5H8N4/c1-4-5(8-2-6-1)9-3-7-4/h1-2,5,7,9H,3H2,(H,6,8) |
| InChIKey | BSKNPOJPDRMEKP-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |