About 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea
1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea (PubChem CID 22225640) has the molecular formula C22H26F2N6O
and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea.
Molecular Properties
| Compound Name | 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
| PubChem CID | 22225640 |
| Molecular Formula | C22H26F2N6O |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
| SMILES | CN1CCN(CCCNC(=O)Nc2n[nH]c3c(F)c(F)c(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C22H26F2N6O/c1-29-10-12-30(13-11-29)9-5-8-25-22(31)26-21-17-14-16(15-6-3-2-4-7-15)18(23)19(24)20(17)27-28-21/h2-4,6-7,14H,5,8-13H2,1H3,(H3,25,26,27,28,31) |
| InChIKey | XQNSNRRJMMZBTC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea?
The IUPAC name of 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea (CID 22225640) is 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea.
What is the SMILES notation for 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea?
The canonical SMILES for 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea is CN1CCN(CCCNC(=O)Nc2n[nH]c3c(F)c(F)c(-c4ccccc4)cc23)CC1.
What is the InChIKey of 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea?
The InChIKey is XQNSNRRJMMZBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26F2N6O/c1-29-10-12-30(13-11-29)9-5-8-25-22(31)26-21-17-14-16(15-6-3-2-4-7-15)18(23)19(24)20(17)27-28-21/h2-4,6-7,14H,5,8-13H2,1H3,(H3,25,26,27,28,31).
What are the key properties of 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea?
1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea has a molecular weight of 428.49 g/mol, XLogP of 3.27, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea is sourced from PubChem (CID 22225640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).