About 2,6-dichlorobenzonitrile
2,6-dichlorobenzonitrile (PubChem CID 22226138) has the molecular formula C14H6Cl4N2
and a molecular weight of 344.03 g/mol. Its IUPAC name is 2,6-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 2,6-dichlorobenzonitrile |
| PubChem CID | 22226138 |
| Molecular Formula | C14H6Cl4N2 |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 2,6-dichlorobenzonitrile |
| SMILES | N#Cc1c(Cl)cccc1Cl.N#Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/2C7H3Cl2N/c2*8-6-2-1-3-7(9)5(6)4-10/h2*1-3H |
| InChIKey | WBJJBRRNIRLWFK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorobenzonitrile?
The IUPAC name of 2,6-dichlorobenzonitrile (CID 22226138) is 2,6-dichlorobenzonitrile.
What is the SMILES notation for 2,6-dichlorobenzonitrile?
The canonical SMILES for 2,6-dichlorobenzonitrile is N#Cc1c(Cl)cccc1Cl.N#Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2,6-dichlorobenzonitrile?
The InChIKey is WBJJBRRNIRLWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H3Cl2N/c2*8-6-2-1-3-7(9)5(6)4-10/h2*1-3H.
What are the key properties of 2,6-dichlorobenzonitrile?
2,6-dichlorobenzonitrile has a molecular weight of 344.03 g/mol, XLogP of 5.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorobenzonitrile is sourced from PubChem (CID 22226138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).