C12H20F9NO3S — CID 22226161
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tetraethylazanium (PubChem CID 22226161) has the molecular formula C12H20F9NO3S and a molecular weight of 429.35 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 22226161 |
| Molecular Formula | C12H20F9NO3S |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H20N.C4HF9O3S/c1-5-9(6-2,7-3)8-4;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h5-8H2,1-4H3;(H,14,15,16)/q+1;/p-1 |
| InChIKey | QTRJKFBGNXKFFF-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|