About [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate
[4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate (PubChem CID 22226442) has the molecular formula C34H30O8S
and a molecular weight of 598.67 g/mol. Its IUPAC name is [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate.
Molecular Properties
| Compound Name | [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate |
| PubChem CID | 22226442 |
| Molecular Formula | C34H30O8S |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate |
| SMILES | Cc1ccc(SC2OC(CO)C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30O8S/c1-22-17-19-26(20-18-22)43-34-30(42-33(38)25-15-9-4-10-16-25)29(41-32(37)24-13-7-3-8-14-24)28(27(21-35)39-34)40-31(36)23-11-5-2-6-12-23/h2-20,27-30,34-35H,21H2,1H3 |
| InChIKey | VGOJOKPAEVYVKR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate?
The IUPAC name of [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate (CID 22226442) is [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate.
What is the SMILES notation for [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate?
The canonical SMILES for [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate is Cc1ccc(SC2OC(CO)C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)cc1.
What is the InChIKey of [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate?
The InChIKey is VGOJOKPAEVYVKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30O8S/c1-22-17-19-26(20-18-22)43-34-30(42-33(38)25-15-9-4-10-16-25)29(41-32(37)24-13-7-3-8-14-24)28(27(21-35)39-34)40-31(36)23-11-5-2-6-12-23/h2-20,27-30,34-35H,21H2,1H3.
What are the key properties of [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate?
[4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate has a molecular weight of 598.67 g/mol, XLogP of 5.48, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate is sourced from PubChem (CID 22226442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).