C22H25Cl2N5O4 — CID 22226509
8-[chloro-(6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione;hydrochloride (PubChem CID 22226509) has the molecular formula C22H25Cl2N5O4 and a molecular weight of 494.38 g/mol. Its IUPAC name is 8-[chloro-(6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione;hydrochloride.
| Compound Name | 8-[chloro-(6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 22226509 |
| Molecular Formula | C22H25Cl2N5O4 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 8-[chloro-(6,7-dimethoxyisoquinolin-4-yl)methyl]-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione;hydrochloride |
| SMILES | COc1cc2cncc(C(Cl)c3nc4c([nH]3)c(=O)n(C)c(=O)n4CC(C)C)c2cc1OC.Cl |
| InChI | InChI=1S/C22H24ClN5O4.ClH/c1-11(2)10-28-20-18(21(29)27(3)22(28)30)25-19(26-20)17(23)14-9-24-8-12-6-15(31-4)16(32-5)7-13(12)14;/h6-9,11,17H,10H2,1-5H3,(H,25,26);1H |
| InChIKey | XYBABWDFROAVQQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|