About azane;urea
azane;urea (PubChem CID 22227373) has the molecular formula CH7N3O
and a molecular weight of 77.09 g/mol. Its IUPAC name is azane;urea.
Molecular Properties
| Compound Name | azane;urea |
| PubChem CID | 22227373 |
| Molecular Formula | CH7N3O |
| Molecular Weight | 77.09 g/mol |
| Exact Mass | 77.06 |
| IUPAC Name | azane;urea |
| SMILES | N.NC(N)=O |
| InChI | InChI=1S/CH4N2O.H3N/c2-1(3)4;/h(H4,2,3,4);1H3 |
| InChIKey | PPBAJDRXASKAGH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.09 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;urea?
The IUPAC name of azane;urea (CID 22227373) is azane;urea.
What is the SMILES notation for azane;urea?
The canonical SMILES for azane;urea is N.NC(N)=O.
What is the InChIKey of azane;urea?
The InChIKey is PPBAJDRXASKAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.H3N/c2-1(3)4;/h(H4,2,3,4);1H3.
What are the key properties of azane;urea?
azane;urea has a molecular weight of 77.09 g/mol, XLogP of -0.81, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;urea is sourced from PubChem (CID 22227373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).