About N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide
N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide (PubChem CID 22228276) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide |
| PubChem CID | 22228276 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide |
| SMILES | CC(=O)NC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C9H12N2O2/c1-7(12)10-9(13)11-8-5-3-2-4-6-8/h3,5-6H,2,4H2,1H3,(H2,10,11,12,13) |
| InChIKey | TYYCELLTMLQMRZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide (CID 22228276) is N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide is CC(=O)NC(=O)NC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide?
The InChIKey is TYYCELLTMLQMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7(12)10-9(13)11-8-5-3-2-4-6-8/h3,5-6H,2,4H2,1H3,(H2,10,11,12,13).
What are the key properties of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide?
N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide has a molecular weight of 180.21 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)acetamide is sourced from PubChem (CID 22228276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).