About Silylnorbornene
Silylnorbornene (PubChem CID 22228902) has the molecular formula C7H9Si
and a molecular weight of 121.23 g/mol.
Molecular Properties
| Compound Name | Silylnorbornene |
| PubChem CID | 22228902 |
| Molecular Formula | C7H9Si |
| Molecular Weight | 121.23 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | — |
| SMILES | [Si]C12C=CC(CC1)C2 |
| InChI | InChI=1S/C7H9Si/c8-7-3-1-6(5-7)2-4-7/h1,3,6H,2,4-5H2 |
| InChIKey | UPXMPLFFRVELEW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Silylnorbornene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silylnorbornene?
The IUPAC name of Silylnorbornene (CID 22228902) is not available.
What is the SMILES notation for Silylnorbornene?
The canonical SMILES for Silylnorbornene is [Si]C12C=CC(CC1)C2.
What is the InChIKey of Silylnorbornene?
The InChIKey is UPXMPLFFRVELEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Si/c8-7-3-1-6(5-7)2-4-7/h1,3,6H,2,4-5H2.
What are the key properties of Silylnorbornene?
Silylnorbornene has a molecular weight of 121.23 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silylnorbornene is sourced from PubChem (CID 22228902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).