About acetic acid;1,2-benzoxazole
acetic acid;1,2-benzoxazole (PubChem CID 22229327) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is acetic acid;1,2-benzoxazole.
Molecular Properties
| Compound Name | acetic acid;1,2-benzoxazole |
| PubChem CID | 22229327 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | acetic acid;1,2-benzoxazole |
| SMILES | CC(=O)O.c1ccc2oncc2c1 |
| InChI | InChI=1S/C7H5NO.C2H4O2/c1-2-4-7-6(3-1)5-8-9-7;1-2(3)4/h1-5H;1H3,(H,3,4) |
| InChIKey | DODXVGQZQIEBHX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1,2-benzoxazole?
The IUPAC name of acetic acid;1,2-benzoxazole (CID 22229327) is acetic acid;1,2-benzoxazole.
What is the SMILES notation for acetic acid;1,2-benzoxazole?
The canonical SMILES for acetic acid;1,2-benzoxazole is CC(=O)O.c1ccc2oncc2c1.
What is the InChIKey of acetic acid;1,2-benzoxazole?
The InChIKey is DODXVGQZQIEBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C2H4O2/c1-2-4-7-6(3-1)5-8-9-7;1-2(3)4/h1-5H;1H3,(H,3,4).
What are the key properties of acetic acid;1,2-benzoxazole?
acetic acid;1,2-benzoxazole has a molecular weight of 179.17 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,2-benzoxazole is sourced from PubChem (CID 22229327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).