C25H24O11 — CID 22229415
[2,3,4,4-tetraacetyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-3-yl] acetate (PubChem CID 22229415) has the molecular formula C25H24O11 and a molecular weight of 500.46 g/mol. Its IUPAC name is [2,3,4,4-tetraacetyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-3-yl] acetate.
| Compound Name | [2,3,4,4-tetraacetyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-3-yl] acetate |
|---|---|
| PubChem CID | 22229415 |
| Molecular Formula | C25H24O11 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | [2,3,4,4-tetraacetyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-3-yl] acetate |
| SMILES | CC(=O)OC1(C(C)=O)C(C(C)=O)(c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c2C1(C(C)=O)C(C)=O |
| InChI | InChI=1S/C25H24O11/c1-11(26)23(12(2)27)22-20(34)9-17(31)10-21(22)36-24(13(3)28,16-6-7-18(32)19(33)8-16)25(23,14(4)29)35-15(5)30/h6-10,31-34H,1-5H3 |
| InChIKey | AGWFPSAAFVKHGA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|