About 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid
3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22229432) has the molecular formula C26H34F2N2O5
and a molecular weight of 492.56 g/mol. Its IUPAC name is 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
Molecular Properties
| Compound Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| PubChem CID | 22229432 |
| Molecular Formula | C26H34F2N2O5 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H34F2N2O5/c1-3-5-6-7-14-30(26(33)29-20-10-13-22(27)23(28)18-20)15-16-35-21-11-8-19(9-12-21)17-24(25(31)32)34-4-2/h8-13,18,24H,3-7,14-17H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | ZWSGKYIFVBCNKG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid?
The IUPAC name of 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (CID 22229432) is 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
What is the SMILES notation for 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid?
The canonical SMILES for 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid is CCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid?
The InChIKey is ZWSGKYIFVBCNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34F2N2O5/c1-3-5-6-7-14-30(26(33)29-20-10-13-22(27)23(28)18-20)15-16-35-21-11-8-19(9-12-21)17-24(25(31)32)34-4-2/h8-13,18,24H,3-7,14-17H2,1-2H3,(H,29,33)(H,31,32).
What are the key properties of 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid?
3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid has a molecular weight of 492.56 g/mol, XLogP of 5.49, 15 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-[(3,4-difluorophenyl)carbamoyl-hexylamino]ethoxy]phenyl]-2-ethoxypropanoic acid is sourced from PubChem (CID 22229432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).