C26H32F4N2O5 — CID 22229536
2-ethoxy-3-[4-[2-[(4-fluorophenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22229536) has the molecular formula C26H32F4N2O5 and a molecular weight of 528.54 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-fluorophenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-fluorophenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229536 |
| Molecular Formula | C26H32F4N2O5 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-fluorophenyl)carbamoyl-(6,6,6-trifluorohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCC(F)(F)F)C(=O)Nc2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H32F4N2O5/c1-2-36-23(24(33)34)18-19-6-12-22(13-7-19)37-17-16-32(15-5-3-4-14-26(28,29)30)25(35)31-21-10-8-20(27)9-11-21/h6-13,23H,2-5,14-18H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | ZCYSYHGDLNNTBA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|