About 2-phenylacridin-9-amine
2-phenylacridin-9-amine (PubChem CID 22231) has the molecular formula C19H14N2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-phenylacridin-9-amine.
Molecular Properties
| Compound Name | 2-phenylacridin-9-amine |
| PubChem CID | 22231 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-phenylacridin-9-amine |
| SMILES | Nc1c2ccccc2nc2ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H14N2/c20-19-15-8-4-5-9-17(15)21-18-11-10-14(12-16(18)19)13-6-2-1-3-7-13/h1-12H,(H2,20,21) |
| InChIKey | YHGAGMNSWODGFY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylacridin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylacridin-9-amine?
The IUPAC name of 2-phenylacridin-9-amine (CID 22231) is 2-phenylacridin-9-amine.
What is the SMILES notation for 2-phenylacridin-9-amine?
The canonical SMILES for 2-phenylacridin-9-amine is Nc1c2ccccc2nc2ccc(-c3ccccc3)cc12.
What is the InChIKey of 2-phenylacridin-9-amine?
The InChIKey is YHGAGMNSWODGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2/c20-19-15-8-4-5-9-17(15)21-18-11-10-14(12-16(18)19)13-6-2-1-3-7-13/h1-12H,(H2,20,21).
What are the key properties of 2-phenylacridin-9-amine?
2-phenylacridin-9-amine has a molecular weight of 270.33 g/mol, XLogP of 4.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylacridin-9-amine is sourced from PubChem (CID 22231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).