About N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide
N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide (PubChem CID 2223231) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide.
Molecular Properties
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide |
| PubChem CID | 2223231 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide |
| SMILES | CC1CCC(NC(=O)C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H20N2O4/c1-10-2-4-11(5-3-10)17-15(19)16(20)18-12-6-7-13-14(8-12)22-9-21-13/h6-8,10-11H,2-5,9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | KTOFACMYFWLKMT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide?
The IUPAC name of N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide (CID 2223231) is N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide.
What is the SMILES notation for N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide?
The canonical SMILES for N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide is CC1CCC(NC(=O)C(=O)Nc2ccc3c(c2)OCO3)CC1.
What is the InChIKey of N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide?
The InChIKey is KTOFACMYFWLKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-10-2-4-11(5-3-10)17-15(19)16(20)18-12-6-7-13-14(8-12)22-9-21-13/h6-8,10-11H,2-5,9H2,1H3,(H,17,19)(H,18,20).
What are the key properties of N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide?
N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide has a molecular weight of 304.35 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,3-benzodioxol-5-yl)-N-(4-methylcyclohexyl)oxamide is sourced from PubChem (CID 2223231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).