About N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide
N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide (PubChem CID 2223279) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
| PubChem CID | 2223279 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)N(Cc2ccccc2)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C19H20N2O2/c1-12-9-13(2)18-16(10-12)17(20-14(3)22)19(23)21(18)11-15-7-5-4-6-8-15/h4-10,17H,11H2,1-3H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | HFCDPNGTVSUYMJ-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The IUPAC name of N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide (CID 2223279) is N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide.
What is the SMILES notation for N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The canonical SMILES for N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide is CC(=O)N[C@H]1C(=O)N(Cc2ccccc2)c2c(C)cc(C)cc21.
What is the InChIKey of N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
The InChIKey is HFCDPNGTVSUYMJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-12-9-13(2)18-16(10-12)17(20-14(3)22)19(23)21(18)11-15-7-5-4-6-8-15/h4-10,17H,11H2,1-3H3,(H,20,22)/t17-/m1/s1.
What are the key properties of N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide?
N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide has a molecular weight of 308.38 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-benzyl-5,7-dimethyl-2-oxo-3H-indol-3-yl]acetamide is sourced from PubChem (CID 2223279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).