About biphenylene;methane
biphenylene;methane (PubChem CID 22235154) has the molecular formula C13H12
and a molecular weight of 168.24 g/mol. Its IUPAC name is biphenylene;methane.
Molecular Properties
| Compound Name | biphenylene;methane |
| PubChem CID | 22235154 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | biphenylene;methane |
| SMILES | C.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.CH4/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;/h1-8H;1H4 |
| InChIKey | VZFQOWRKGJDEBG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze biphenylene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;methane?
The IUPAC name of biphenylene;methane (CID 22235154) is biphenylene;methane.
What is the SMILES notation for biphenylene;methane?
The canonical SMILES for biphenylene;methane is C.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;methane?
The InChIKey is VZFQOWRKGJDEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.CH4/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;/h1-8H;1H4.
What are the key properties of biphenylene;methane?
biphenylene;methane has a molecular weight of 168.24 g/mol, XLogP of 3.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;methane is sourced from PubChem (CID 22235154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).