About 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide
4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide (PubChem CID 22235208) has the molecular formula C11H5Cl2F2N3O2
and a molecular weight of 320.08 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide.
Molecular Properties
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide |
| PubChem CID | 22235208 |
| Molecular Formula | C11H5Cl2F2N3O2 |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide |
| SMILES | NC(=O)c1cc(F)c(-n2ncc(Cl)c(Cl)c2=O)cc1F |
| InChI | InChI=1S/C11H5Cl2F2N3O2/c12-5-3-17-18(11(20)9(5)13)8-2-6(14)4(10(16)19)1-7(8)15/h1-3H,(H2,16,19) |
| InChIKey | PCMIMROGTWUKCA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide?
The IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide (CID 22235208) is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide.
What is the SMILES notation for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide?
The canonical SMILES for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide is NC(=O)c1cc(F)c(-n2ncc(Cl)c(Cl)c2=O)cc1F.
What is the InChIKey of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide?
The InChIKey is PCMIMROGTWUKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2F2N3O2/c12-5-3-17-18(11(20)9(5)13)8-2-6(14)4(10(16)19)1-7(8)15/h1-3H,(H2,16,19).
What are the key properties of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide?
4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide has a molecular weight of 320.08 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-2,5-difluorobenzamide is sourced from PubChem (CID 22235208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).