C22H21N5O5S — CID 22235720
4-[2-[3-(4-nitrophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]ethoxy]benzene-1,3-dicarbonitrile (PubChem CID 22235720) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is 4-[2-[3-(4-nitrophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]ethoxy]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[2-[3-(4-nitrophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]ethoxy]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 22235720 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[2-[3-(4-nitrophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octan-8-yl]ethoxy]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(OCCN2C3CCC2CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C3)c(C#N)c1 |
| InChI | InChI=1S/C22H21N5O5S/c23-12-16-1-8-22(17(11-16)13-24)32-10-9-26-19-2-3-20(26)15-25(14-19)33(30,31)21-6-4-18(5-7-21)27(28)29/h1,4-8,11,19-20H,2-3,9-10,14-15H2 |
| InChIKey | INPWQOYDRCRZBG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 140.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|