About N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide
N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 2223650) has the molecular formula C12H10N2O2S
and a molecular weight of 246.29 g/mol. Its IUPAC name is N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 2223650 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C/c2ccccc2)S1 |
| InChI | InChI=1S/C12H10N2O2S/c1-8(15)13-12-14-11(16)10(17-12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14,15,16)/b10-7- |
| InChIKey | QMKPYQOFBUYLQJ-YFHOEESVSA-N |
| XLogP | 1.79 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide (CID 2223650) is N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide is CC(=O)NC1=NC(=O)/C(=C/c2ccccc2)S1.
What is the InChIKey of N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide?
The InChIKey is QMKPYQOFBUYLQJ-YFHOEESVSA-N. The full InChI is InChI=1S/C12H10N2O2S/c1-8(15)13-12-14-11(16)10(17-12)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14,15,16)/b10-7-.
What are the key properties of N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide?
N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide has a molecular weight of 246.29 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5Z)-5-benzylidene-4-oxo-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 2223650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).