About 3-amino-2,5-dimethylphenol
3-amino-2,5-dimethylphenol (PubChem CID 22236615) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-amino-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 3-amino-2,5-dimethylphenol |
| PubChem CID | 22236615 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-amino-2,5-dimethylphenol |
| SMILES | Cc1cc(N)c(C)c(O)c1 |
| InChI | InChI=1S/C8H11NO/c1-5-3-7(9)6(2)8(10)4-5/h3-4,10H,9H2,1-2H3 |
| InChIKey | XXTSEVBNJZNFLL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,5-dimethylphenol?
The IUPAC name of 3-amino-2,5-dimethylphenol (CID 22236615) is 3-amino-2,5-dimethylphenol.
What is the SMILES notation for 3-amino-2,5-dimethylphenol?
The canonical SMILES for 3-amino-2,5-dimethylphenol is Cc1cc(N)c(C)c(O)c1.
What is the InChIKey of 3-amino-2,5-dimethylphenol?
The InChIKey is XXTSEVBNJZNFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-5-3-7(9)6(2)8(10)4-5/h3-4,10H,9H2,1-2H3.
What are the key properties of 3-amino-2,5-dimethylphenol?
3-amino-2,5-dimethylphenol has a molecular weight of 137.18 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,5-dimethylphenol is sourced from PubChem (CID 22236615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).