About 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine
5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine (PubChem CID 22236620) has the molecular formula C16H10Br2FNO2S2
and a molecular weight of 491.20 g/mol. Its IUPAC name is 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine.
Molecular Properties
| Compound Name | 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine |
| PubChem CID | 22236620 |
| Molecular Formula | C16H10Br2FNO2S2 |
| Molecular Weight | 491.20 g/mol |
| Exact Mass | 488.85 |
| IUPAC Name | 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine |
| SMILES | CS(=O)(=O)c1ccc(-c2c(Br)sc(Br)c2-c2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C16H10Br2FNO2S2/c1-24(21,22)11-5-2-9(3-6-11)13-14(16(18)23-15(13)17)10-4-7-12(19)20-8-10/h2-8H,1H3 |
| InChIKey | GUBMSPHMCVXCLG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.20 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine?
The IUPAC name of 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine (CID 22236620) is 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine.
What is the SMILES notation for 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine?
The canonical SMILES for 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine is CS(=O)(=O)c1ccc(-c2c(Br)sc(Br)c2-c2ccc(F)nc2)cc1.
What is the InChIKey of 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine?
The InChIKey is GUBMSPHMCVXCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2FNO2S2/c1-24(21,22)11-5-2-9(3-6-11)13-14(16(18)23-15(13)17)10-4-7-12(19)20-8-10/h2-8H,1H3.
What are the key properties of 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine?
5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine has a molecular weight of 491.20 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,5-dibromo-4-(4-methylsulfonylphenyl)thiophen-3-yl]-2-fluoropyridine is sourced from PubChem (CID 22236620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).