About 1-prop-2-ynoxyethanamine
1-prop-2-ynoxyethanamine (PubChem CID 22236862) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 1-prop-2-ynoxyethanamine.
Molecular Properties
| Compound Name | 1-prop-2-ynoxyethanamine |
| PubChem CID | 22236862 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 1-prop-2-ynoxyethanamine |
| SMILES | C#CCOC(C)N |
| InChI | InChI=1S/C5H9NO/c1-3-4-7-5(2)6/h1,5H,4,6H2,2H3 |
| InChIKey | PJEDPWJHBOFJQE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-ynoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-ynoxyethanamine?
The IUPAC name of 1-prop-2-ynoxyethanamine (CID 22236862) is 1-prop-2-ynoxyethanamine.
What is the SMILES notation for 1-prop-2-ynoxyethanamine?
The canonical SMILES for 1-prop-2-ynoxyethanamine is C#CCOC(C)N.
What is the InChIKey of 1-prop-2-ynoxyethanamine?
The InChIKey is PJEDPWJHBOFJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-3-4-7-5(2)6/h1,5H,4,6H2,2H3.
What are the key properties of 1-prop-2-ynoxyethanamine?
1-prop-2-ynoxyethanamine has a molecular weight of 99.13 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-ynoxyethanamine is sourced from PubChem (CID 22236862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).