C12H15F5O3 — CID 22237067
1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluoro-3-methoxybutane-1,3-diol (PubChem CID 22237067) has the molecular formula C12H15F5O3 and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluoro-3-methoxybutane-1,3-diol.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluoro-3-methoxybutane-1,3-diol |
|---|---|
| PubChem CID | 22237067 |
| Molecular Formula | C12H15F5O3 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluoro-3-methoxybutane-1,3-diol |
| SMILES | COC(O)(C(F)(F)F)C(F)(F)C(O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C12H15F5O3/c1-20-11(19,12(15,16)17)10(13,14)9(18)8-5-6-2-3-7(8)4-6/h2-3,6-9,18-19H,4-5H2,1H3 |
| InChIKey | QYNSUXMCSNIZJN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|