C12H15F5O3 — CID 22237070
4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,2,4-triol (PubChem CID 22237070) has the molecular formula C12H15F5O3 and a molecular weight of 302.24 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,2,4-triol.
| Compound Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,2,4-triol |
|---|---|
| PubChem CID | 22237070 |
| Molecular Formula | C12H15F5O3 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3-pentafluoropentane-2,2,4-triol |
| SMILES | CC(O)(C1CC2C=CC1C2)C(F)(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H15F5O3/c1-9(18,8-5-6-2-3-7(8)4-6)10(13,14)11(19,20)12(15,16)17/h2-3,6-8,18-20H,4-5H2,1H3 |
| InChIKey | XUUPABFIIHGVAB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|