C15H16 — CID 22237211
tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene (PubChem CID 22237211) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene.
| Compound Name | tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene |
|---|---|
| PubChem CID | 22237211 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene |
| SMILES | C1=CC2CC1C1Cc3ccccc3CC21 |
| InChI | InChI=1S/C15H16/c1-2-4-11-9-15-13-6-5-12(7-13)14(15)8-10(11)3-1/h1-6,12-15H,7-9H2 |
| InChIKey | FBZNZJCZXOHDHW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|