About 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol
4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol (PubChem CID 22237238) has the molecular formula C26H22O4S
and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol.
Molecular Properties
| Compound Name | 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol |
| PubChem CID | 22237238 |
| Molecular Formula | C26H22O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2cc(-c3ccccc3)c(O)c(C)c2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C26H22O4S/c1-17-15-21(13-14-23(17)27)31(29,30)24-16-22(19-9-5-3-6-10-19)26(28)18(2)25(24)20-11-7-4-8-12-20/h3-16,27-28H,1-2H3 |
| InChIKey | QSLAKBNCTPQSMQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol?
The IUPAC name of 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol (CID 22237238) is 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol.
What is the SMILES notation for 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol?
The canonical SMILES for 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol is Cc1cc(S(=O)(=O)c2cc(-c3ccccc3)c(O)c(C)c2-c2ccccc2)ccc1O.
What is the InChIKey of 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol?
The InChIKey is QSLAKBNCTPQSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O4S/c1-17-15-21(13-14-23(17)27)31(29,30)24-16-22(19-9-5-3-6-10-19)26(28)18(2)25(24)20-11-7-4-8-12-20/h3-16,27-28H,1-2H3.
What are the key properties of 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol?
4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol has a molecular weight of 430.53 g/mol, XLogP of 5.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methyl-3,6-diphenylphenol is sourced from PubChem (CID 22237238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).