C12H12Br2N2 — CID 22237892
7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-3,5,7,9,11,13-hexaene dibromide (PubChem CID 22237892) has the molecular formula C12H12Br2N2 and a molecular weight of 344.05 g/mol. Its IUPAC name is 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-3,5,7,9,11,13-hexaene dibromide.
| Compound Name | 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-3,5,7,9,11,13-hexaene dibromide |
|---|---|
| PubChem CID | 22237892 |
| Molecular Formula | C12H12Br2N2 |
| Molecular Weight | 344.05 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 7,10-diazoniatricyclo[8.4.0.02,7]tetradeca-3,5,7,9,11,13-hexaene dibromide |
| SMILES | C1=CC2C3C=CC=C[N+]3=CC=[N+]2C=C1.[Br-].[Br-] |
| InChI | InChI=1S/C12H12N2.2BrH/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1;;/h1-12H;2*1H/q+2;;/p-2 |
| InChIKey | JMWOMZMFBCIJMW-UHFFFAOYSA-L |
| XLogP | -4.92 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.05 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|