About 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride
2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride (PubChem CID 22238018) has the molecular formula C9H12ClNS
and a molecular weight of 201.72 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride.
Analyze 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride?
The IUPAC name of 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride (CID 22238018) is 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride.
What is the SMILES notation for 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride?
The canonical SMILES for 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride is Cl.c1ccc2c(c1)CNCCS2.
What is the InChIKey of 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride?
The InChIKey is MHQHPDMXJONCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS.ClH/c1-2-4-9-8(3-1)7-10-5-6-11-9;/h1-4,10H,5-7H2;1H.
What are the key properties of 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride?
2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride has a molecular weight of 201.72 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride is sourced from PubChem (CID 22238018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).