About [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid
[2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid (PubChem CID 22238085) has the molecular formula C13H16INO3
and a molecular weight of 361.18 g/mol. Its IUPAC name is [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid.
Molecular Properties
| Compound Name | [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid |
| PubChem CID | 22238085 |
| Molecular Formula | C13H16INO3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid |
| SMILES | Cc1c(NC(=O)O)cc2c(c1C)OC(C)(CI)C2 |
| InChI | InChI=1S/C13H16INO3/c1-7-8(2)11-9(4-10(7)15-12(16)17)5-13(3,6-14)18-11/h4,15H,5-6H2,1-3H3,(H,16,17) |
| InChIKey | BMVITNYKJREMHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid?
The IUPAC name of [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid (CID 22238085) is [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid.
What is the SMILES notation for [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid?
The canonical SMILES for [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid is Cc1c(NC(=O)O)cc2c(c1C)OC(C)(CI)C2.
What is the InChIKey of [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid?
The InChIKey is BMVITNYKJREMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16INO3/c1-7-8(2)11-9(4-10(7)15-12(16)17)5-13(3,6-14)18-11/h4,15H,5-6H2,1-3H3,(H,16,17).
What are the key properties of [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid?
[2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid has a molecular weight of 361.18 g/mol, XLogP of 3.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(iodomethyl)-2,6,7-trimethyl-3H-1-benzofuran-5-yl]carbamic acid is sourced from PubChem (CID 22238085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).