About 2-(dichloromethyl)-2-methyl-1,3-dithiane
2-(dichloromethyl)-2-methyl-1,3-dithiane (PubChem CID 22238776) has the molecular formula C6H10Cl2S2
and a molecular weight of 217.19 g/mol. Its IUPAC name is 2-(dichloromethyl)-2-methyl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-2-methyl-1,3-dithiane |
| PubChem CID | 22238776 |
| Molecular Formula | C6H10Cl2S2 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 2-(dichloromethyl)-2-methyl-1,3-dithiane |
| SMILES | CC1(C(Cl)Cl)SCCCS1 |
| InChI | InChI=1S/C6H10Cl2S2/c1-6(5(7)8)9-3-2-4-10-6/h5H,2-4H2,1H3 |
| InChIKey | DMRGIAWAXUPICA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-2-methyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-2-methyl-1,3-dithiane?
The IUPAC name of 2-(dichloromethyl)-2-methyl-1,3-dithiane (CID 22238776) is 2-(dichloromethyl)-2-methyl-1,3-dithiane.
What is the SMILES notation for 2-(dichloromethyl)-2-methyl-1,3-dithiane?
The canonical SMILES for 2-(dichloromethyl)-2-methyl-1,3-dithiane is CC1(C(Cl)Cl)SCCCS1.
What is the InChIKey of 2-(dichloromethyl)-2-methyl-1,3-dithiane?
The InChIKey is DMRGIAWAXUPICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2S2/c1-6(5(7)8)9-3-2-4-10-6/h5H,2-4H2,1H3.
What are the key properties of 2-(dichloromethyl)-2-methyl-1,3-dithiane?
2-(dichloromethyl)-2-methyl-1,3-dithiane has a molecular weight of 217.19 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-2-methyl-1,3-dithiane is sourced from PubChem (CID 22238776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).