About 4-phenylcyclohexa-1,5-diene-1-carboxamide
4-phenylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 22238857) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-phenylcyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 4-phenylcyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 22238857 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-phenylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | NC(=O)C1=CCC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C13H13NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-6,8-9,11H,7H2,(H2,14,15) |
| InChIKey | JLIZMQUAUBHOPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylcyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylcyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of 4-phenylcyclohexa-1,5-diene-1-carboxamide (CID 22238857) is 4-phenylcyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for 4-phenylcyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for 4-phenylcyclohexa-1,5-diene-1-carboxamide is NC(=O)C1=CCC(c2ccccc2)C=C1.
What is the InChIKey of 4-phenylcyclohexa-1,5-diene-1-carboxamide?
The InChIKey is JLIZMQUAUBHOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-6,8-9,11H,7H2,(H2,14,15).
What are the key properties of 4-phenylcyclohexa-1,5-diene-1-carboxamide?
4-phenylcyclohexa-1,5-diene-1-carboxamide has a molecular weight of 199.25 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylcyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 22238857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).